C20H26NOSSi+ — CID 102181888
trimethyl-[naphthalen-2-yl-(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)methoxy]silane (PubChem CID 102181888) has the molecular formula C20H26NOSSi+ and a molecular weight of 356.59 g/mol. Its IUPAC name is trimethyl-[naphthalen-2-yl-(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)methoxy]silane.
| Compound Name | trimethyl-[naphthalen-2-yl-(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)methoxy]silane |
|---|---|
| PubChem CID | 102181888 |
| Molecular Formula | C20H26NOSSi+ |
| Molecular Weight | 356.59 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | trimethyl-[naphthalen-2-yl-(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)methoxy]silane |
| SMILES | Cc1sc(C(O[Si](C)(C)C)c2ccc3ccccc3c2)[n+](C)c1C |
| InChI | InChI=1S/C20H26NOSSi/c1-14-15(2)23-20(21(14)3)19(22-24(4,5)6)18-12-11-16-9-7-8-10-17(16)13-18/h7-13,19H,1-6H3/q+1 |
| InChIKey | WBZRWRNHGBWGCZ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|