C28H34O2Si2 — CID 10575884
(1,2-dinaphthalen-2-yl-2-trimethylsilyloxyethoxy)-trimethylsilane (PubChem CID 10575884) has the molecular formula C28H34O2Si2 and a molecular weight of 458.75 g/mol. Its IUPAC name is (1,2-dinaphthalen-2-yl-2-trimethylsilyloxyethoxy)-trimethylsilane.
| Compound Name | (1,2-dinaphthalen-2-yl-2-trimethylsilyloxyethoxy)-trimethylsilane |
|---|---|
| PubChem CID | 10575884 |
| Molecular Formula | C28H34O2Si2 |
| Molecular Weight | 458.75 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | (1,2-dinaphthalen-2-yl-2-trimethylsilyloxyethoxy)-trimethylsilane |
| SMILES | C[Si](C)(C)OC(c1ccc2ccccc2c1)C(O[Si](C)(C)C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H34O2Si2/c1-31(2,3)29-27(25-17-15-21-11-7-9-13-23(21)19-25)28(30-32(4,5)6)26-18-16-22-12-8-10-14-24(22)20-26/h7-20,27-28H,1-6H3 |
| InChIKey | PJPPBJWZDPFEJQ-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.75 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|