C22H20N2 — CID 14048524
(1R,2S)-1,2-dinaphthalen-2-ylethane-1,2-diamine (PubChem CID 14048524) has the molecular formula C22H20N2 and a molecular weight of 312.42 g/mol. Its IUPAC name is (1R,2S)-1,2-dinaphthalen-2-ylethane-1,2-diamine.
| Compound Name | (1R,2S)-1,2-dinaphthalen-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 14048524 |
| Molecular Formula | C22H20N2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (1R,2S)-1,2-dinaphthalen-2-ylethane-1,2-diamine |
| SMILES | N[C@H](c1ccc2ccccc2c1)[C@@H](N)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H20N2/c23-21(19-11-9-15-5-1-3-7-17(15)13-19)22(24)20-12-10-16-6-2-4-8-18(16)14-20/h1-14,21-22H,23-24H2/t21-,22+ |
| InChIKey | FAHMSYSXFWQYOW-SZPZYZBQSA-N |
| XLogP | 4.69 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |