C20H18BrN — CID 53241965
(1R,2R)-2-(4-bromophenyl)-1-naphthalen-2-ylbut-3-en-1-amine (PubChem CID 53241965) has the molecular formula C20H18BrN and a molecular weight of 352.28 g/mol. Its IUPAC name is (1R,2R)-2-(4-bromophenyl)-1-naphthalen-2-ylbut-3-en-1-amine.
| Compound Name | (1R,2R)-2-(4-bromophenyl)-1-naphthalen-2-ylbut-3-en-1-amine |
|---|---|
| PubChem CID | 53241965 |
| Molecular Formula | C20H18BrN |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | (1R,2R)-2-(4-bromophenyl)-1-naphthalen-2-ylbut-3-en-1-amine |
| SMILES | C=C[C@H](c1ccc(Br)cc1)[C@@H](N)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H18BrN/c1-2-19(15-9-11-18(21)12-10-15)20(22)17-8-7-14-5-3-4-6-16(14)13-17/h2-13,19-20H,1,22H2/t19-,20+/m1/s1 |
| InChIKey | PFUYXVJFMIJELF-UXHICEINSA-N |
| XLogP | 5.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|