C10H7Br — CID 50940586
2-bromonaphthalene (PubChem CID 50940586) has the molecular formula C10H7Br and a molecular weight of 213.02 g/mol. Its IUPAC name is 2-bromonaphthalene.
| Compound Name | 2-bromonaphthalene |
|---|---|
| PubChem CID | 50940586 |
| Molecular Formula | C10H7Br |
| Molecular Weight | 213.02 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 2-bromonaphthalene |
| SMILES | Br[13c]1[13cH][13cH][13c]2cccc[13c]2[13cH]1 |
| InChI | InChI=1S/C10H7Br/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H/i5+1,6+1,7+1,8+1,9+1,10+1 |
| InChIKey | APSMUYYLXZULMS-CYRQOIGNSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.02 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |