About 2-bromonaphthalene;phenol
2-bromonaphthalene;phenol (PubChem CID 174920874) has the molecular formula C16H13BrO
and a molecular weight of 301.18 g/mol. Its IUPAC name is 2-bromonaphthalene;phenol.
Molecular Properties
| Compound Name | 2-bromonaphthalene;phenol |
| PubChem CID | 174920874 |
| Molecular Formula | C16H13BrO |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 2-bromonaphthalene;phenol |
| SMILES | Brc1ccc2ccccc2c1.Oc1ccccc1 |
| InChI | InChI=1S/C10H7Br.C6H6O/c11-10-6-5-8-3-1-2-4-9(8)7-10;7-6-4-2-1-3-5-6/h1-7H;1-5,7H |
| InChIKey | IAMWZOZPWYMRPC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromonaphthalene;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromonaphthalene;phenol?
The IUPAC name of 2-bromonaphthalene;phenol (CID 174920874) is 2-bromonaphthalene;phenol.
What is the SMILES notation for 2-bromonaphthalene;phenol?
The canonical SMILES for 2-bromonaphthalene;phenol is Brc1ccc2ccccc2c1.Oc1ccccc1.
What is the InChIKey of 2-bromonaphthalene;phenol?
The InChIKey is IAMWZOZPWYMRPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Br.C6H6O/c11-10-6-5-8-3-1-2-4-9(8)7-10;7-6-4-2-1-3-5-6/h1-7H;1-5,7H.
What are the key properties of 2-bromonaphthalene;phenol?
2-bromonaphthalene;phenol has a molecular weight of 301.18 g/mol, XLogP of 4.99, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromonaphthalene;phenol is sourced from PubChem (CID 174920874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).