About 3-bromoanthracen-9-ol
3-bromoanthracen-9-ol (PubChem CID 23035853) has the molecular formula C14H9BrO
and a molecular weight of 273.13 g/mol. Its IUPAC name is 3-bromoanthracen-9-ol.
Molecular Properties
| Compound Name | 3-bromoanthracen-9-ol |
| PubChem CID | 23035853 |
| Molecular Formula | C14H9BrO |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 3-bromoanthracen-9-ol |
| SMILES | Oc1c2ccccc2cc2cc(Br)ccc12 |
| InChI | InChI=1S/C14H9BrO/c15-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)14(13)16/h1-8,16H |
| InChIKey | IADCIQQQCSNKFH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-bromoanthracen-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromoanthracen-9-ol?
The IUPAC name of 3-bromoanthracen-9-ol (CID 23035853) is 3-bromoanthracen-9-ol.
What is the SMILES notation for 3-bromoanthracen-9-ol?
The canonical SMILES for 3-bromoanthracen-9-ol is Oc1c2ccccc2cc2cc(Br)ccc12.
What is the InChIKey of 3-bromoanthracen-9-ol?
The InChIKey is IADCIQQQCSNKFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9BrO/c15-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)14(13)16/h1-8,16H.
What are the key properties of 3-bromoanthracen-9-ol?
3-bromoanthracen-9-ol has a molecular weight of 273.13 g/mol, XLogP of 4.46, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromoanthracen-9-ol is sourced from PubChem (CID 23035853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).