C18H11Br — CID 59412531
3-bromo-7,12-dideuteriobenzo[a]anthracene (PubChem CID 59412531) has the molecular formula C18H11Br and a molecular weight of 309.20 g/mol. Its IUPAC name is 3-bromo-7,12-dideuteriobenzo[a]anthracene.
| Compound Name | 3-bromo-7,12-dideuteriobenzo[a]anthracene |
|---|---|
| PubChem CID | 59412531 |
| Molecular Formula | C18H11Br |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 3-bromo-7,12-dideuteriobenzo[a]anthracene |
| SMILES | [2H]c1c2ccccc2c([2H])c2c1ccc1cc(Br)ccc12 |
| InChI | InChI=1S/C18H11Br/c19-16-7-8-17-15(10-16)6-5-14-9-12-3-1-2-4-13(12)11-18(14)17/h1-11H/i9D,11D |
| InChIKey | GXWOCNFNSJDQLY-TVSHPJQCSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|