About 2,6-dibromonaphthalene
2,6-dibromonaphthalene (PubChem CID 640591) has the molecular formula C10H6Br2
and a molecular weight of 285.97 g/mol. Its IUPAC name is 2,6-dibromonaphthalene.
Molecular Properties
| Compound Name | 2,6-dibromonaphthalene |
| PubChem CID | 640591 |
| Molecular Formula | C10H6Br2 |
| Molecular Weight | 285.97 g/mol |
| Exact Mass | 283.88 |
| IUPAC Name | 2,6-dibromonaphthalene |
| SMILES | Brc1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C10H6Br2/c11-9-3-1-7-5-10(12)4-2-8(7)6-9/h1-6H |
| InChIKey | PJZDEYKZSZWFPX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.97 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,6-dibromonaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibromonaphthalene?
The IUPAC name of 2,6-dibromonaphthalene (CID 640591) is 2,6-dibromonaphthalene.
What is the SMILES notation for 2,6-dibromonaphthalene?
The canonical SMILES for 2,6-dibromonaphthalene is Brc1ccc2cc(Br)ccc2c1.
What is the InChIKey of 2,6-dibromonaphthalene?
The InChIKey is PJZDEYKZSZWFPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Br2/c11-9-3-1-7-5-10(12)4-2-8(7)6-9/h1-6H.
What are the key properties of 2,6-dibromonaphthalene?
2,6-dibromonaphthalene has a molecular weight of 285.97 g/mol, XLogP of 4.36, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibromonaphthalene is sourced from PubChem (CID 640591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).