About azane;6-bromophthalazine
azane;6-bromophthalazine (PubChem CID 87747021) has the molecular formula C8H8BrN3
and a molecular weight of 226.08 g/mol. Its IUPAC name is azane;6-bromophthalazine.
Molecular Properties
| Compound Name | azane;6-bromophthalazine |
| PubChem CID | 87747021 |
| Molecular Formula | C8H8BrN3 |
| Molecular Weight | 226.08 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | azane;6-bromophthalazine |
| SMILES | Brc1ccc2cnncc2c1.N |
| InChI | InChI=1S/C8H5BrN2.H3N/c9-8-2-1-6-4-10-11-5-7(6)3-8;/h1-5H;1H3 |
| InChIKey | CWAGRLITKDBJIJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 60.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.08 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;6-bromophthalazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;6-bromophthalazine?
The IUPAC name of azane;6-bromophthalazine (CID 87747021) is azane;6-bromophthalazine.
What is the SMILES notation for azane;6-bromophthalazine?
The canonical SMILES for azane;6-bromophthalazine is Brc1ccc2cnncc2c1.N.
What is the InChIKey of azane;6-bromophthalazine?
The InChIKey is CWAGRLITKDBJIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5BrN2.H3N/c9-8-2-1-6-4-10-11-5-7(6)3-8;/h1-5H;1H3.
What are the key properties of azane;6-bromophthalazine?
azane;6-bromophthalazine has a molecular weight of 226.08 g/mol, XLogP of 2.55, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;6-bromophthalazine is sourced from PubChem (CID 87747021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).