C14H10O3 — CID 11342
anthracene-1,2,10-triol (PubChem CID 11342) has the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. Its IUPAC name is anthracene-1,2,10-triol.
| Compound Name | anthracene-1,2,10-triol |
|---|---|
| PubChem CID | 11342 |
| Molecular Formula | C14H10O3 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | anthracene-1,2,10-triol |
| SMILES | Oc1ccc2c(O)c3ccccc3cc2c1O |
| InChI | InChI=1S/C14H10O3/c15-12-6-5-10-11(14(12)17)7-8-3-1-2-4-9(8)13(10)16/h1-7,15-17H |
| InChIKey | TZIQWQARHPGHIG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|