C14H11NO3 — CID 90904436
3-aminoanthracene-2,9,10-triol (PubChem CID 90904436) has the molecular formula C14H11NO3 and a molecular weight of 241.25 g/mol. Its IUPAC name is 3-aminoanthracene-2,9,10-triol.
| Compound Name | 3-aminoanthracene-2,9,10-triol |
|---|---|
| PubChem CID | 90904436 |
| Molecular Formula | C14H11NO3 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 3-aminoanthracene-2,9,10-triol |
| SMILES | Nc1cc2c(O)c3ccccc3c(O)c2cc1O |
| InChI | InChI=1S/C14H11NO3/c15-11-5-9-10(6-12(11)16)14(18)8-4-2-1-3-7(8)13(9)17/h1-6,16-18H,15H2 |
| InChIKey | IUYBLURZMVGAEM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|