About 10-azatricyclo[7.1.1.02,7]undeca-1(11),2,4,6,8-pentaen-8-ol
10-azatricyclo[7.1.1.02,7]undeca-1(11),2,4,6,8-pentaen-8-ol (PubChem CID 174364509) has the molecular formula C10H7NO
and a molecular weight of 157.17 g/mol. Its IUPAC name is 10-azatricyclo[7.1.1.02,7]undeca-1(11),2,4,6,8-pentaen-8-ol.
Analyze 10-azatricyclo[7.1.1.02,7]undeca-1(11),2,4,6,8-pentaen-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-azatricyclo[7.1.1.02,7]undeca-1(11),2,4,6,8-pentaen-8-ol?
The IUPAC name of 10-azatricyclo[7.1.1.02,7]undeca-1(11),2,4,6,8-pentaen-8-ol (CID 174364509) is 10-azatricyclo[7.1.1.02,7]undeca-1(11),2,4,6,8-pentaen-8-ol.
What is the SMILES notation for 10-azatricyclo[7.1.1.02,7]undeca-1(11),2,4,6,8-pentaen-8-ol?
The canonical SMILES for 10-azatricyclo[7.1.1.02,7]undeca-1(11),2,4,6,8-pentaen-8-ol is Oc1c2cc([nH]2)c2ccccc12.
What is the InChIKey of 10-azatricyclo[7.1.1.02,7]undeca-1(11),2,4,6,8-pentaen-8-ol?
The InChIKey is BHKPIONEGKMKBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO/c12-10-7-4-2-1-3-6(7)8-5-9(10)11-8/h1-5,11-12H.
What are the key properties of 10-azatricyclo[7.1.1.02,7]undeca-1(11),2,4,6,8-pentaen-8-ol?
10-azatricyclo[7.1.1.02,7]undeca-1(11),2,4,6,8-pentaen-8-ol has a molecular weight of 157.17 g/mol, XLogP of 2.46, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-azatricyclo[7.1.1.02,7]undeca-1(11),2,4,6,8-pentaen-8-ol is sourced from PubChem (CID 174364509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).