C10H10N2O2 — CID 82254150
1,4-diaminonaphthalene-2,3-diol (PubChem CID 82254150) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 1,4-diaminonaphthalene-2,3-diol.
| Compound Name | 1,4-diaminonaphthalene-2,3-diol |
|---|---|
| PubChem CID | 82254150 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 1,4-diaminonaphthalene-2,3-diol |
| SMILES | Nc1c(O)c(O)c(N)c2ccccc12 |
| InChI | InChI=1S/C10H10N2O2/c11-7-5-3-1-2-4-6(5)8(12)10(14)9(7)13/h1-4,13-14H,11-12H2 |
| InChIKey | VLAVJAMNZQLIRP-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|