C10H8NO4S- — CID 148794117
3-amino-1,4-dihydroxynaphthalene-2-sulfinate (PubChem CID 148794117) has the molecular formula C10H8NO4S- and a molecular weight of 238.24 g/mol. Its IUPAC name is 3-amino-1,4-dihydroxynaphthalene-2-sulfinate.
| Compound Name | 3-amino-1,4-dihydroxynaphthalene-2-sulfinate |
|---|---|
| PubChem CID | 148794117 |
| Molecular Formula | C10H8NO4S- |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 3-amino-1,4-dihydroxynaphthalene-2-sulfinate |
| SMILES | Nc1c(S(=O)[O-])c(O)c2ccccc2c1O |
| InChI | InChI=1S/C10H9NO4S/c11-7-8(12)5-3-1-2-4-6(5)9(13)10(7)16(14)15/h1-4,12-13H,11H2,(H,14,15)/p-1 |
| InChIKey | CAEBKDSUVFZJRG-UHFFFAOYSA-M |
| XLogP | 1.07 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|