C6H5O7S- — CID 59101885
2,3,4,5,6-pentahydroxybenzenesulfinate (PubChem CID 59101885) has the molecular formula C6H5O7S- and a molecular weight of 221.17 g/mol. Its IUPAC name is 2,3,4,5,6-pentahydroxybenzenesulfinate.
| Compound Name | 2,3,4,5,6-pentahydroxybenzenesulfinate |
|---|---|
| PubChem CID | 59101885 |
| Molecular Formula | C6H5O7S- |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 220.98 |
| IUPAC Name | 2,3,4,5,6-pentahydroxybenzenesulfinate |
| SMILES | O=S([O-])c1c(O)c(O)c(O)c(O)c1O |
| InChI | InChI=1S/C6H6O7S/c7-1-2(8)4(10)6(14(12)13)5(11)3(1)9/h7-11H,(H,12,13)/p-1 |
| InChIKey | WPKCDFHHYLYBDO-UHFFFAOYSA-M |
| XLogP | -0.55 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|