About hydrogen sulfite;scandium
hydrogen sulfite;scandium (PubChem CID 174863397) has the molecular formula HO3SSc-
and a molecular weight of 126.03 g/mol. Its IUPAC name is hydrogen sulfite;scandium.
Molecular Properties
| Compound Name | hydrogen sulfite;scandium |
| PubChem CID | 174863397 |
| Molecular Formula | HO3SSc- |
| Molecular Weight | 126.03 g/mol |
| Exact Mass | 125.92 |
| IUPAC Name | hydrogen sulfite;scandium |
| SMILES | O=S([O-])O.[Sc] |
| InChI | InChI=1S/H2O3S.Sc/c1-4(2)3;/h(H2,1,2,3);/p-1 |
| InChIKey | CVAFLZUPGYDYCY-UHFFFAOYSA-M |
| XLogP | -0.66 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.03 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze hydrogen sulfite;scandium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen sulfite;scandium?
The IUPAC name of hydrogen sulfite;scandium (CID 174863397) is hydrogen sulfite;scandium.
What is the SMILES notation for hydrogen sulfite;scandium?
The canonical SMILES for hydrogen sulfite;scandium is O=S([O-])O.[Sc].
What is the InChIKey of hydrogen sulfite;scandium?
The InChIKey is CVAFLZUPGYDYCY-UHFFFAOYSA-M. The full InChI is InChI=1S/H2O3S.Sc/c1-4(2)3;/h(H2,1,2,3);/p-1.
What are the key properties of hydrogen sulfite;scandium?
hydrogen sulfite;scandium has a molecular weight of 126.03 g/mol, XLogP of -0.66, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfite;scandium is sourced from PubChem (CID 174863397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).