About hydrogen sulfite;zinc;dihydrate
hydrogen sulfite;zinc;dihydrate (PubChem CID 66545802) has the molecular formula H5O5SZn-
and a molecular weight of 182.49 g/mol. Its IUPAC name is hydrogen sulfite;zinc;dihydrate.
Molecular Properties
| Compound Name | hydrogen sulfite;zinc;dihydrate |
| PubChem CID | 66545802 |
| Molecular Formula | H5O5SZn- |
| Molecular Weight | 182.49 g/mol |
| Exact Mass | 180.92 |
| IUPAC Name | hydrogen sulfite;zinc;dihydrate |
| SMILES | O.O.O=S([O-])O.[Zn] |
| InChI | InChI=1S/H2O3S.2H2O.Zn/c1-4(2)3;;;/h(H2,1,2,3);2*1H2;/p-1 |
| InChIKey | QOUQGADYCSEBEV-UHFFFAOYSA-M |
| XLogP | -2.31 |
| TPSA | 123.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.49 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze hydrogen sulfite;zinc;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrogen sulfite;zinc;dihydrate?
The IUPAC name of hydrogen sulfite;zinc;dihydrate (CID 66545802) is hydrogen sulfite;zinc;dihydrate.
What is the SMILES notation for hydrogen sulfite;zinc;dihydrate?
The canonical SMILES for hydrogen sulfite;zinc;dihydrate is O.O.O=S([O-])O.[Zn].
What is the InChIKey of hydrogen sulfite;zinc;dihydrate?
The InChIKey is QOUQGADYCSEBEV-UHFFFAOYSA-M. The full InChI is InChI=1S/H2O3S.2H2O.Zn/c1-4(2)3;;;/h(H2,1,2,3);2*1H2;/p-1.
What are the key properties of hydrogen sulfite;zinc;dihydrate?
hydrogen sulfite;zinc;dihydrate has a molecular weight of 182.49 g/mol, XLogP of -2.31, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydrogen sulfite;zinc;dihydrate is sourced from PubChem (CID 66545802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).