C11H8NO5S- — CID 54715880
2-[(R)-(4-hydroxy-2-oxo-1H-quinolin-3-yl)sulfinyl]acetate (PubChem CID 54715880) has the molecular formula C11H8NO5S- and a molecular weight of 266.25 g/mol. Its IUPAC name is 2-[(R)-(4-hydroxy-2-oxo-1H-quinolin-3-yl)sulfinyl]acetate.
| Compound Name | 2-[(R)-(4-hydroxy-2-oxo-1H-quinolin-3-yl)sulfinyl]acetate |
|---|---|
| PubChem CID | 54715880 |
| Molecular Formula | C11H8NO5S- |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 2-[(R)-(4-hydroxy-2-oxo-1H-quinolin-3-yl)sulfinyl]acetate |
| SMILES | O=C([O-])C[S@@](=O)c1c(O)c2ccccc2[nH]c1=O |
| InChI | InChI=1S/C11H9NO5S/c13-8(14)5-18(17)10-9(15)6-3-1-2-4-7(6)12-11(10)16/h1-4H,5H2,(H,13,14)(H2,12,15,16)/p-1/t18-/m1/s1 |
| InChIKey | IMCBULNKFBKBLH-GOSISDBHSA-M |
| XLogP | -0.91 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |