C10H8N2O2S2 — CID 175845399
(4-hydroxy-2-oxo-1H-quinolin-3-yl)carbamodithioic acid (PubChem CID 175845399) has the molecular formula C10H8N2O2S2 and a molecular weight of 252.32 g/mol. Its IUPAC name is (4-hydroxy-2-oxo-1H-quinolin-3-yl)carbamodithioic acid.
| Compound Name | (4-hydroxy-2-oxo-1H-quinolin-3-yl)carbamodithioic acid |
|---|---|
| PubChem CID | 175845399 |
| Molecular Formula | C10H8N2O2S2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | (4-hydroxy-2-oxo-1H-quinolin-3-yl)carbamodithioic acid |
| SMILES | O=c1[nH]c2ccccc2c(O)c1NC(=S)S |
| InChI | InChI=1S/C10H8N2O2S2/c13-8-5-3-1-2-4-6(5)11-9(14)7(8)12-10(15)16/h1-4H,(H2,11,13,14)(H2,12,15,16) |
| InChIKey | OXBNBFLCAPWUDA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|