C17H11Br2N3O4 — CID 54076718
1-(3,5-dibromophenyl)-3-(5-hydroxy-2,3-dioxo-1H-1-benzazepin-4-yl)urea (PubChem CID 54076718) has the molecular formula C17H11Br2N3O4 and a molecular weight of 481.10 g/mol. Its IUPAC name is 1-(3,5-dibromophenyl)-3-(5-hydroxy-2,3-dioxo-1H-1-benzazepin-4-yl)urea.
| Compound Name | 1-(3,5-dibromophenyl)-3-(5-hydroxy-2,3-dioxo-1H-1-benzazepin-4-yl)urea |
|---|---|
| PubChem CID | 54076718 |
| Molecular Formula | C17H11Br2N3O4 |
| Molecular Weight | 481.10 g/mol |
| Exact Mass | 478.91 |
| IUPAC Name | 1-(3,5-dibromophenyl)-3-(5-hydroxy-2,3-dioxo-1H-1-benzazepin-4-yl)urea |
| SMILES | O=C(Nc1cc(Br)cc(Br)c1)Nc1c(O)c2ccccc2[nH]c(=O)c1=O |
| InChI | InChI=1S/C17H11Br2N3O4/c18-8-5-9(19)7-10(6-8)20-17(26)22-13-14(23)11-3-1-2-4-12(11)21-16(25)15(13)24/h1-7H,(H4,20,21,22,23,24,25,26) |
| InChIKey | MKFLUGUVLWFRLZ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.10 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|