About 2-aminonaphthalen-1-ol;ethane
2-aminonaphthalen-1-ol;ethane (PubChem CID 143085377) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-aminonaphthalen-1-ol;ethane.
Molecular Properties
| Compound Name | 2-aminonaphthalen-1-ol;ethane |
| PubChem CID | 143085377 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 2-aminonaphthalen-1-ol;ethane |
| SMILES | CC.Nc1ccc2ccccc2c1O |
| InChI | InChI=1S/C10H9NO.C2H6/c11-9-6-5-7-3-1-2-4-8(7)10(9)12;1-2/h1-6,12H,11H2;1-2H3 |
| InChIKey | GSXYUTUXFPEUDG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-aminonaphthalen-1-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminonaphthalen-1-ol;ethane?
The IUPAC name of 2-aminonaphthalen-1-ol;ethane (CID 143085377) is 2-aminonaphthalen-1-ol;ethane.
What is the SMILES notation for 2-aminonaphthalen-1-ol;ethane?
The canonical SMILES for 2-aminonaphthalen-1-ol;ethane is CC.Nc1ccc2ccccc2c1O.
What is the InChIKey of 2-aminonaphthalen-1-ol;ethane?
The InChIKey is GSXYUTUXFPEUDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO.C2H6/c11-9-6-5-7-3-1-2-4-8(7)10(9)12;1-2/h1-6,12H,11H2;1-2H3.
What are the key properties of 2-aminonaphthalen-1-ol;ethane?
2-aminonaphthalen-1-ol;ethane has a molecular weight of 189.26 g/mol, XLogP of 3.15, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminonaphthalen-1-ol;ethane is sourced from PubChem (CID 143085377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).