C12H15ClN2 — CID 175607443
1-N,1-N-dimethylnaphthalene-1,2-diamine;hydrochloride (PubChem CID 175607443) has the molecular formula C12H15ClN2 and a molecular weight of 222.72 g/mol. Its IUPAC name is 1-N,1-N-dimethylnaphthalene-1,2-diamine;hydrochloride.
| Compound Name | 1-N,1-N-dimethylnaphthalene-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 175607443 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 1-N,1-N-dimethylnaphthalene-1,2-diamine;hydrochloride |
| SMILES | CN(C)c1c(N)ccc2ccccc12.Cl |
| InChI | InChI=1S/C12H14N2.ClH/c1-14(2)12-10-6-4-3-5-9(10)7-8-11(12)13;/h3-8H,13H2,1-2H3;1H |
| InChIKey | HMHIYWXARFEKFR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|