C13H16ClN — CID 174570104
N,N,1-trimethylnaphthalen-2-amine;hydrochloride (PubChem CID 174570104) has the molecular formula C13H16ClN and a molecular weight of 221.73 g/mol. Its IUPAC name is N,N,1-trimethylnaphthalen-2-amine;hydrochloride.
| Compound Name | N,N,1-trimethylnaphthalen-2-amine;hydrochloride |
|---|---|
| PubChem CID | 174570104 |
| Molecular Formula | C13H16ClN |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | N,N,1-trimethylnaphthalen-2-amine;hydrochloride |
| SMILES | Cc1c(N(C)C)ccc2ccccc12.Cl |
| InChI | InChI=1S/C13H15N.ClH/c1-10-12-7-5-4-6-11(12)8-9-13(10)14(2)3;/h4-9H,1-3H3;1H |
| InChIKey | HJLZXKNDIABEBO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |