C18H23N — CID 154699282
N-cyclohexyl-N,1-dimethylnaphthalen-2-amine (PubChem CID 154699282) has the molecular formula C18H23N and a molecular weight of 253.39 g/mol. Its IUPAC name is N-cyclohexyl-N,1-dimethylnaphthalen-2-amine.
| Compound Name | N-cyclohexyl-N,1-dimethylnaphthalen-2-amine |
|---|---|
| PubChem CID | 154699282 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | N-cyclohexyl-N,1-dimethylnaphthalen-2-amine |
| SMILES | Cc1c(N(C)C2CCCCC2)ccc2ccccc12 |
| InChI | InChI=1S/C18H23N/c1-14-17-11-7-6-8-15(17)12-13-18(14)19(2)16-9-4-3-5-10-16/h6-8,11-13,16H,3-5,9-10H2,1-2H3 |
| InChIKey | MZDLXJXPPWVZMB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |