C18H20N2Se — CID 176910255
N-cyclohexyl-N-methylbenzo[g][1,3]benzoselenazol-2-amine (PubChem CID 176910255) has the molecular formula C18H20N2Se and a molecular weight of 343.33 g/mol. Its IUPAC name is N-cyclohexyl-N-methylbenzo[g][1,3]benzoselenazol-2-amine.
| Compound Name | N-cyclohexyl-N-methylbenzo[g][1,3]benzoselenazol-2-amine |
|---|---|
| PubChem CID | 176910255 |
| Molecular Formula | C18H20N2Se |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | N-cyclohexyl-N-methylbenzo[g][1,3]benzoselenazol-2-amine |
| SMILES | CN(c1nc2ccc3ccccc3c2[se]1)C1CCCCC1 |
| InChI | InChI=1S/C18H20N2Se/c1-20(14-8-3-2-4-9-14)18-19-16-12-11-13-7-5-6-10-15(13)17(16)21-18/h5-7,10-12,14H,2-4,8-9H2,1H3 |
| InChIKey | ZRCXJRIBXWXRAK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|