C13H18FN — CID 66962308
N-cyclopentyl-3-fluoro-N,2-dimethylaniline (PubChem CID 66962308) has the molecular formula C13H18FN and a molecular weight of 207.29 g/mol. Its IUPAC name is N-cyclopentyl-3-fluoro-N,2-dimethylaniline.
| Compound Name | N-cyclopentyl-3-fluoro-N,2-dimethylaniline |
|---|---|
| PubChem CID | 66962308 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | N-cyclopentyl-3-fluoro-N,2-dimethylaniline |
| SMILES | Cc1c(F)cccc1N(C)C1CCCC1 |
| InChI | InChI=1S/C13H18FN/c1-10-12(14)8-5-9-13(10)15(2)11-6-3-4-7-11/h5,8-9,11H,3-4,6-7H2,1-2H3 |
| InChIKey | SELWIWODFDXFDO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |