C12H17FN2O — CID 60790197
3-fluoro-1-N-methyl-1-N-(oxan-4-yl)benzene-1,2-diamine (PubChem CID 60790197) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is 3-fluoro-1-N-methyl-1-N-(oxan-4-yl)benzene-1,2-diamine.
| Compound Name | 3-fluoro-1-N-methyl-1-N-(oxan-4-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 60790197 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 3-fluoro-1-N-methyl-1-N-(oxan-4-yl)benzene-1,2-diamine |
| SMILES | CN(c1cccc(F)c1N)C1CCOCC1 |
| InChI | InChI=1S/C12H17FN2O/c1-15(9-5-7-16-8-6-9)11-4-2-3-10(13)12(11)14/h2-4,9H,5-8,14H2,1H3 |
| InChIKey | AQPTVPGHYHEPKT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|