C13H20N2 — CID 63077474
3-N-cyclopentyl-3-N,2-dimethylbenzene-1,3-diamine (PubChem CID 63077474) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 3-N-cyclopentyl-3-N,2-dimethylbenzene-1,3-diamine.
| Compound Name | 3-N-cyclopentyl-3-N,2-dimethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 63077474 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 3-N-cyclopentyl-3-N,2-dimethylbenzene-1,3-diamine |
| SMILES | Cc1c(N)cccc1N(C)C1CCCC1 |
| InChI | InChI=1S/C13H20N2/c1-10-12(14)8-5-9-13(10)15(2)11-6-3-4-7-11/h5,8-9,11H,3-4,6-7,14H2,1-2H3 |
| InChIKey | ACMMIKRIOQFUAV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|