C14H15N — CID 152636612
1-ethenyl-N,N-dimethylnaphthalen-2-amine (PubChem CID 152636612) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-ethenyl-N,N-dimethylnaphthalen-2-amine.
| Compound Name | 1-ethenyl-N,N-dimethylnaphthalen-2-amine |
|---|---|
| PubChem CID | 152636612 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-ethenyl-N,N-dimethylnaphthalen-2-amine |
| SMILES | C=Cc1c(N(C)C)ccc2ccccc12 |
| InChI | InChI=1S/C14H15N/c1-4-12-13-8-6-5-7-11(13)9-10-14(12)15(2)3/h4-10H,1H2,2-3H3 |
| InChIKey | ZEQYMEOSNFUEDV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |