About CID 89262500
CID 89262500 (PubChem CID 89262500) has the molecular formula C14H10Na2O2
and a molecular weight of 256.21 g/mol.
Molecular Properties
| Compound Name | CID 89262500 |
| PubChem CID | 89262500 |
| Molecular Formula | C14H10Na2O2 |
| Molecular Weight | 256.21 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | — |
| SMILES | Oc1ccc2cc3ccccc3cc2c1O.[Na].[Na] |
| InChI | InChI=1S/C14H10O2.2Na/c15-13-6-5-11-7-9-3-1-2-4-10(9)8-12(11)14(13)16;;/h1-8,15-16H;; |
| InChIKey | BIRHSIRRXFUWNP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.21 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze CID 89262500 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89262500?
The IUPAC name of CID 89262500 (CID 89262500) is not available.
What is the SMILES notation for CID 89262500?
The canonical SMILES for CID 89262500 is Oc1ccc2cc3ccccc3cc2c1O.[Na].[Na].
What is the InChIKey of CID 89262500?
The InChIKey is BIRHSIRRXFUWNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O2.2Na/c15-13-6-5-11-7-9-3-1-2-4-10(9)8-12(11)14(13)16;;/h1-8,15-16H;;.
What are the key properties of CID 89262500?
CID 89262500 has a molecular weight of 256.21 g/mol, XLogP of 2.64, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89262500 is sourced from PubChem (CID 89262500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).