About benzo[a]anthracen-1-ol;methane
benzo[a]anthracen-1-ol;methane (PubChem CID 88728153) has the molecular formula C19H16O
and a molecular weight of 260.34 g/mol. Its IUPAC name is benzo[a]anthracen-1-ol;methane.
Molecular Properties
| Compound Name | benzo[a]anthracen-1-ol;methane |
| PubChem CID | 88728153 |
| Molecular Formula | C19H16O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | benzo[a]anthracen-1-ol;methane |
| SMILES | C.Oc1cccc2ccc3cc4ccccc4cc3c12 |
| InChI | InChI=1S/C18H12O.CH4/c19-17-7-3-6-12-8-9-15-10-13-4-1-2-5-14(13)11-16(15)18(12)17;/h1-11,19H;1H4 |
| InChIKey | YHLFQSJSUQMJJO-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[a]anthracen-1-ol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[a]anthracen-1-ol;methane?
The IUPAC name of benzo[a]anthracen-1-ol;methane (CID 88728153) is benzo[a]anthracen-1-ol;methane.
What is the SMILES notation for benzo[a]anthracen-1-ol;methane?
The canonical SMILES for benzo[a]anthracen-1-ol;methane is C.Oc1cccc2ccc3cc4ccccc4cc3c12.
What is the InChIKey of benzo[a]anthracen-1-ol;methane?
The InChIKey is YHLFQSJSUQMJJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O.CH4/c19-17-7-3-6-12-8-9-15-10-13-4-1-2-5-14(13)11-16(15)18(12)17;/h1-11,19H;1H4.
What are the key properties of benzo[a]anthracen-1-ol;methane?
benzo[a]anthracen-1-ol;methane has a molecular weight of 260.34 g/mol, XLogP of 5.49, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[a]anthracen-1-ol;methane is sourced from PubChem (CID 88728153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).