About azane;benzo[a]anthracen-1-ol
azane;benzo[a]anthracen-1-ol (PubChem CID 87178862) has the molecular formula C18H15NO
and a molecular weight of 261.32 g/mol. Its IUPAC name is azane;benzo[a]anthracen-1-ol.
Molecular Properties
| Compound Name | azane;benzo[a]anthracen-1-ol |
| PubChem CID | 87178862 |
| Molecular Formula | C18H15NO |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | azane;benzo[a]anthracen-1-ol |
| SMILES | N.Oc1cccc2ccc3cc4ccccc4cc3c12 |
| InChI | InChI=1S/C18H12O.H3N/c19-17-7-3-6-12-8-9-15-10-13-4-1-2-5-14(13)11-16(15)18(12)17;/h1-11,19H;1H3 |
| InChIKey | BCKZXQWTHHUNIM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze azane;benzo[a]anthracen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;benzo[a]anthracen-1-ol?
The IUPAC name of azane;benzo[a]anthracen-1-ol (CID 87178862) is azane;benzo[a]anthracen-1-ol.
What is the SMILES notation for azane;benzo[a]anthracen-1-ol?
The canonical SMILES for azane;benzo[a]anthracen-1-ol is N.Oc1cccc2ccc3cc4ccccc4cc3c12.
What is the InChIKey of azane;benzo[a]anthracen-1-ol?
The InChIKey is BCKZXQWTHHUNIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O.H3N/c19-17-7-3-6-12-8-9-15-10-13-4-1-2-5-14(13)11-16(15)18(12)17;/h1-11,19H;1H3.
What are the key properties of azane;benzo[a]anthracen-1-ol?
azane;benzo[a]anthracen-1-ol has a molecular weight of 261.32 g/mol, XLogP of 5.01, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;benzo[a]anthracen-1-ol is sourced from PubChem (CID 87178862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).