About chrysene-3,4-diol
chrysene-3,4-diol (PubChem CID 23622151) has the molecular formula C18H12O2
and a molecular weight of 260.29 g/mol. Its IUPAC name is chrysene-3,4-diol.
Molecular Properties
| Compound Name | chrysene-3,4-diol |
| PubChem CID | 23622151 |
| Molecular Formula | C18H12O2 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | chrysene-3,4-diol |
| SMILES | Oc1ccc2ccc3c4ccccc4ccc3c2c1O |
| InChI | InChI=1S/C18H12O2/c19-16-10-7-12-6-8-14-13-4-2-1-3-11(13)5-9-15(14)17(12)18(16)20/h1-10,19-20H |
| InChIKey | UGKFHEQQQKMGGB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze chrysene-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chrysene-3,4-diol?
The IUPAC name of chrysene-3,4-diol (CID 23622151) is chrysene-3,4-diol.
What is the SMILES notation for chrysene-3,4-diol?
The canonical SMILES for chrysene-3,4-diol is Oc1ccc2ccc3c4ccccc4ccc3c2c1O.
What is the InChIKey of chrysene-3,4-diol?
The InChIKey is UGKFHEQQQKMGGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O2/c19-16-10-7-12-6-8-14-13-4-2-1-3-11(13)5-9-15(14)17(12)18(16)20/h1-10,19-20H.
What are the key properties of chrysene-3,4-diol?
chrysene-3,4-diol has a molecular weight of 260.29 g/mol, XLogP of 4.56, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chrysene-3,4-diol is sourced from PubChem (CID 23622151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).