C44H32O16 — CID 165025673
tetrakis(carbon dioxide);naphthalene-1,2-diol;naphthalene-1,3-diol;naphthalene-1,4-diol;naphthalene-2,6-diol (PubChem CID 165025673) has the molecular formula C44H32O16 and a molecular weight of 816.72 g/mol. Its IUPAC name is tetrakis(carbon dioxide);naphthalene-1,2-diol;naphthalene-1,3-diol;naphthalene-1,4-diol;naphthalene-2,6-diol.
| Compound Name | tetrakis(carbon dioxide);naphthalene-1,2-diol;naphthalene-1,3-diol;naphthalene-1,4-diol;naphthalene-2,6-diol |
|---|---|
| PubChem CID | 165025673 |
| Molecular Formula | C44H32O16 |
| Molecular Weight | 816.72 g/mol |
| Exact Mass | 816.17 |
| IUPAC Name | tetrakis(carbon dioxide);naphthalene-1,2-diol;naphthalene-1,3-diol;naphthalene-1,4-diol;naphthalene-2,6-diol |
| SMILES | O=C=O.O=C=O.O=C=O.O=C=O.Oc1cc(O)c2ccccc2c1.Oc1ccc(O)c2ccccc12.Oc1ccc2cc(O)ccc2c1.Oc1ccc2ccccc2c1O |
| InChI | InChI=1S/4C10H8O2.4CO2/c11-9-3-1-7-5-10(12)4-2-8(7)6-9;11-8-5-7-3-1-2-4-9(7)10(12)6-8;11-9-5-6-10(12)8-4-2-1-3-7(8)9;11-9-6-5-7-3-1-2-4-8(7)10(9)12;4*2-1-3/h4*1-6,11-12H;;;; |
| InChIKey | LVPGJJFKLMGUCZ-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 298.40 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | |
| Heavy Atoms | 60 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.72 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|