C22H18O6S — CID 158408430
4-(4-hydroxyphenyl)sulfonylphenol;naphthalene-1,2-diol (PubChem CID 158408430) has the molecular formula C22H18O6S and a molecular weight of 410.45 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)sulfonylphenol;naphthalene-1,2-diol.
| Compound Name | 4-(4-hydroxyphenyl)sulfonylphenol;naphthalene-1,2-diol |
|---|---|
| PubChem CID | 158408430 |
| Molecular Formula | C22H18O6S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 4-(4-hydroxyphenyl)sulfonylphenol;naphthalene-1,2-diol |
| SMILES | O=S(=O)(c1ccc(O)cc1)c1ccc(O)cc1.Oc1ccc2ccccc2c1O |
| InChI | InChI=1S/C12H10O4S.C10H8O2/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12;11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-8,13-14H;1-6,11-12H |
| InChIKey | GYZKSWHBQXSPCH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|