C18H14O8 — CID 70365447
3,4-dihydroxyphthalic acid;naphthalene-1,2-diol (PubChem CID 70365447) has the molecular formula C18H14O8 and a molecular weight of 358.30 g/mol. Its IUPAC name is 3,4-dihydroxyphthalic acid;naphthalene-1,2-diol.
| Compound Name | 3,4-dihydroxyphthalic acid;naphthalene-1,2-diol |
|---|---|
| PubChem CID | 70365447 |
| Molecular Formula | C18H14O8 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 3,4-dihydroxyphthalic acid;naphthalene-1,2-diol |
| SMILES | O=C(O)c1ccc(O)c(O)c1C(=O)O.Oc1ccc2ccccc2c1O |
| InChI | InChI=1S/C10H8O2.C8H6O6/c11-9-6-5-7-3-1-2-4-8(7)10(9)12;9-4-2-1-3(7(11)12)5(6(4)10)8(13)14/h1-6,11-12H;1-2,9-10H,(H,11,12)(H,13,14) |
| InChIKey | MBBQAJQQRZFQRG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|