C12H10O5 — CID 67377556
naphthalene-1,2-dicarboxylic acid;hydrate (PubChem CID 67377556) has the molecular formula C12H10O5 and a molecular weight of 234.21 g/mol. Its IUPAC name is naphthalene-1,2-dicarboxylic acid;hydrate.
| Compound Name | naphthalene-1,2-dicarboxylic acid;hydrate |
|---|---|
| PubChem CID | 67377556 |
| Molecular Formula | C12H10O5 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | naphthalene-1,2-dicarboxylic acid;hydrate |
| SMILES | O.O=C(O)c1ccc2ccccc2c1C(=O)O |
| InChI | InChI=1S/C12H8O4.H2O/c13-11(14)9-6-5-7-3-1-2-4-8(7)10(9)12(15)16;/h1-6H,(H,13,14)(H,15,16);1H2 |
| InChIKey | XGTIANDFHSKTHK-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |