C15H12N2O4 — CID 69093080
1H-imidazole;naphthalene-1,2-dicarboxylic acid (PubChem CID 69093080) has the molecular formula C15H12N2O4 and a molecular weight of 284.27 g/mol. Its IUPAC name is 1H-imidazole;naphthalene-1,2-dicarboxylic acid.
| Compound Name | 1H-imidazole;naphthalene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 69093080 |
| Molecular Formula | C15H12N2O4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1H-imidazole;naphthalene-1,2-dicarboxylic acid |
| SMILES | O=C(O)c1ccc2ccccc2c1C(=O)O.c1c[nH]cn1 |
| InChI | InChI=1S/C12H8O4.C3H4N2/c13-11(14)9-6-5-7-3-1-2-4-8(7)10(9)12(15)16;1-2-5-3-4-1/h1-6H,(H,13,14)(H,15,16);1-3H,(H,4,5) |
| InChIKey | ZTAPSYFNLYSONY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 103.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |