C28H20O12 — CID 157108272
benzene-1,3-dicarboxylic acid;naphthalene-1,2-dicarboxylic acid;terephthalic acid (PubChem CID 157108272) has the molecular formula C28H20O12 and a molecular weight of 548.46 g/mol. Its IUPAC name is benzene-1,3-dicarboxylic acid;naphthalene-1,2-dicarboxylic acid;terephthalic acid.
| Compound Name | benzene-1,3-dicarboxylic acid;naphthalene-1,2-dicarboxylic acid;terephthalic acid |
|---|---|
| PubChem CID | 157108272 |
| Molecular Formula | C28H20O12 |
| Molecular Weight | 548.46 g/mol |
| Exact Mass | 548.10 |
| IUPAC Name | benzene-1,3-dicarboxylic acid;naphthalene-1,2-dicarboxylic acid;terephthalic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)cc1.O=C(O)c1ccc2ccccc2c1C(=O)O.O=C(O)c1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C12H8O4.2C8H6O4/c13-11(14)9-6-5-7-3-1-2-4-8(7)10(9)12(15)16;9-7(10)5-1-2-6(4-3-5)8(11)12;9-7(10)5-2-1-3-6(4-5)8(11)12/h1-6H,(H,13,14)(H,15,16);2*1-4H,(H,9,10)(H,11,12) |
| InChIKey | AGOAOVQKZJWECT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |