C24H16O8 — CID 158292853
naphthalene-1,2-dicarboxylic acid;naphthalene-1,4-dicarboxylic acid (PubChem CID 158292853) has the molecular formula C24H16O8 and a molecular weight of 432.38 g/mol. Its IUPAC name is naphthalene-1,2-dicarboxylic acid;naphthalene-1,4-dicarboxylic acid.
| Compound Name | naphthalene-1,2-dicarboxylic acid;naphthalene-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 158292853 |
| Molecular Formula | C24H16O8 |
| Molecular Weight | 432.38 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | naphthalene-1,2-dicarboxylic acid;naphthalene-1,4-dicarboxylic acid |
| SMILES | O=C(O)c1ccc(C(=O)O)c2ccccc12.O=C(O)c1ccc2ccccc2c1C(=O)O |
| InChI | InChI=1S/2C12H8O4/c13-11(14)9-5-6-10(12(15)16)8-4-2-1-3-7(8)9;13-11(14)9-6-5-7-3-1-2-4-8(7)10(9)12(15)16/h2*1-6H,(H,13,14)(H,15,16) |
| InChIKey | GLOJPZRZRONPLU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |