C19H13NO5 — CID 163959565
2-[(3-carboxyphenyl)carbamoyl]naphthalene-1-carboxylic acid (PubChem CID 163959565) has the molecular formula C19H13NO5 and a molecular weight of 335.32 g/mol. Its IUPAC name is 2-[(3-carboxyphenyl)carbamoyl]naphthalene-1-carboxylic acid.
| Compound Name | 2-[(3-carboxyphenyl)carbamoyl]naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 163959565 |
| Molecular Formula | C19H13NO5 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 2-[(3-carboxyphenyl)carbamoyl]naphthalene-1-carboxylic acid |
| SMILES | O=C(O)c1cccc(NC(=O)c2ccc3ccccc3c2C(=O)O)c1 |
| InChI | InChI=1S/C19H13NO5/c21-17(20-13-6-3-5-12(10-13)18(22)23)15-9-8-11-4-1-2-7-14(11)16(15)19(24)25/h1-10H,(H,20,21)(H,22,23)(H,24,25) |
| InChIKey | SGHTXYVLBGNBES-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |