C10H10N2O6S — CID 174709210
1H-imidazole;2-sulfooxybenzoic acid (PubChem CID 174709210) has the molecular formula C10H10N2O6S and a molecular weight of 286.26 g/mol. Its IUPAC name is 1H-imidazole;2-sulfooxybenzoic acid.
| Compound Name | 1H-imidazole;2-sulfooxybenzoic acid |
|---|---|
| PubChem CID | 174709210 |
| Molecular Formula | C10H10N2O6S |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 1H-imidazole;2-sulfooxybenzoic acid |
| SMILES | O=C(O)c1ccccc1OS(=O)(=O)O.c1c[nH]cn1 |
| InChI | InChI=1S/C7H6O6S.C3H4N2/c8-7(9)5-3-1-2-4-6(5)13-14(10,11)12;1-2-5-3-4-1/h1-4H,(H,8,9)(H,10,11,12);1-3H,(H,4,5) |
| InChIKey | IVBSKJDECPGICX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 129.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|