About tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxyphenoxy]-dimethylsilane;1H-imidazole;propanoic acid
tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxyphenoxy]-dimethylsilane;1H-imidazole;propanoic acid (PubChem CID 175561795) has the molecular formula C24H44N2O4Si2
and a molecular weight of 480.80 g/mol. Its IUPAC name is tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxyphenoxy]-dimethylsilane;1H-imidazole;propanoic acid.
Molecular Properties
| Compound Name | tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxyphenoxy]-dimethylsilane;1H-imidazole;propanoic acid |
| PubChem CID | 175561795 |
| Molecular Formula | C24H44N2O4Si2 |
| Molecular Weight | 480.80 g/mol |
| Exact Mass | 480.28 |
| IUPAC Name | tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxyphenoxy]-dimethylsilane;1H-imidazole;propanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccccc1O[Si](C)(C)C(C)(C)C.CCC(=O)O.c1c[nH]cn1 |
| InChI | InChI=1S/C18H34O2Si2.C3H4N2.C3H6O2/c1-17(2,3)21(7,8)19-15-13-11-12-14-16(15)20-22(9,10)18(4,5)6;1-2-5-3-4-1;1-2-3(4)5/h11-14H,1-10H3;1-3H,(H,4,5);2H2,1H3,(H,4,5) |
| InChIKey | MWZVNWLWYPBALD-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 84.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.80 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxyphenoxy]-dimethylsilane;1H-imidazole;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxyphenoxy]-dimethylsilane;1H-imidazole;propanoic acid?
The IUPAC name of tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxyphenoxy]-dimethylsilane;1H-imidazole;propanoic acid (CID 175561795) is tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxyphenoxy]-dimethylsilane;1H-imidazole;propanoic acid.
What is the SMILES notation for tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxyphenoxy]-dimethylsilane;1H-imidazole;propanoic acid?
The canonical SMILES for tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxyphenoxy]-dimethylsilane;1H-imidazole;propanoic acid is CC(C)(C)[Si](C)(C)Oc1ccccc1O[Si](C)(C)C(C)(C)C.CCC(=O)O.c1c[nH]cn1.
What is the InChIKey of tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxyphenoxy]-dimethylsilane;1H-imidazole;propanoic acid?
The InChIKey is MWZVNWLWYPBALD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O2Si2.C3H4N2.C3H6O2/c1-17(2,3)21(7,8)19-15-13-11-12-14-16(15)20-22(9,10)18(4,5)6;1-2-5-3-4-1;1-2-3(4)5/h11-14H,1-10H3;1-3H,(H,4,5);2H2,1H3,(H,4,5).
What are the key properties of tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxyphenoxy]-dimethylsilane;1H-imidazole;propanoic acid?
tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxyphenoxy]-dimethylsilane;1H-imidazole;propanoic acid has a molecular weight of 480.80 g/mol, XLogP of 7.35, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[2-[tert-butyl(dimethyl)silyl]oxyphenoxy]-dimethylsilane;1H-imidazole;propanoic acid is sourced from PubChem (CID 175561795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).