About 2-[bis(2-hydroxyethoxy)amino]oxyethanol;2-sulfooxybenzoic acid
2-[bis(2-hydroxyethoxy)amino]oxyethanol;2-sulfooxybenzoic acid (PubChem CID 175437149) has the molecular formula C13H21NO12S
and a molecular weight of 415.37 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethoxy)amino]oxyethanol;2-sulfooxybenzoic acid.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethoxy)amino]oxyethanol;2-sulfooxybenzoic acid |
| PubChem CID | 175437149 |
| Molecular Formula | C13H21NO12S |
| Molecular Weight | 415.37 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 2-[bis(2-hydroxyethoxy)amino]oxyethanol;2-sulfooxybenzoic acid |
| SMILES | O=C(O)c1ccccc1OS(=O)(=O)O.OCCON(OCCO)OCCO |
| InChI | InChI=1S/C7H6O6S.C6H15NO6/c8-7(9)5-3-1-2-4-6(5)13-14(10,11)12;8-1-4-11-7(12-5-2-9)13-6-3-10/h1-4H,(H,8,9)(H,10,11,12);8-10H,1-6H2 |
| InChIKey | NNFPXDWZHPTJAW-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 192.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.37 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[bis(2-hydroxyethoxy)amino]oxyethanol;2-sulfooxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;2-sulfooxybenzoic acid?
The IUPAC name of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;2-sulfooxybenzoic acid (CID 175437149) is 2-[bis(2-hydroxyethoxy)amino]oxyethanol;2-sulfooxybenzoic acid.
What is the SMILES notation for 2-[bis(2-hydroxyethoxy)amino]oxyethanol;2-sulfooxybenzoic acid?
The canonical SMILES for 2-[bis(2-hydroxyethoxy)amino]oxyethanol;2-sulfooxybenzoic acid is O=C(O)c1ccccc1OS(=O)(=O)O.OCCON(OCCO)OCCO.
What is the InChIKey of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;2-sulfooxybenzoic acid?
The InChIKey is NNFPXDWZHPTJAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O6S.C6H15NO6/c8-7(9)5-3-1-2-4-6(5)13-14(10,11)12;8-1-4-11-7(12-5-2-9)13-6-3-10/h1-4H,(H,8,9)(H,10,11,12);8-10H,1-6H2.
What are the key properties of 2-[bis(2-hydroxyethoxy)amino]oxyethanol;2-sulfooxybenzoic acid?
2-[bis(2-hydroxyethoxy)amino]oxyethanol;2-sulfooxybenzoic acid has a molecular weight of 415.37 g/mol, XLogP of -1.37, 12 rotatable bonds, 5 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethoxy)amino]oxyethanol;2-sulfooxybenzoic acid is sourced from PubChem (CID 175437149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).