C14H10O2 — CID 640647
phenanthrene-2,4-diol (PubChem CID 640647) has the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. Its IUPAC name is phenanthrene-2,4-diol.
| Compound Name | phenanthrene-2,4-diol |
|---|---|
| PubChem CID | 640647 |
| Molecular Formula | C14H10O2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | phenanthrene-2,4-diol |
| SMILES | Oc1cc(O)c2c(ccc3ccccc32)c1 |
| InChI | InChI=1S/C14H10O2/c15-11-7-10-6-5-9-3-1-2-4-12(9)14(10)13(16)8-11/h1-8,15-16H |
| InChIKey | CUGIOLWKSJZSDU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|