C15H13ClO — CID 146167139
(2R,3R)-2-chloro-3-naphthalen-2-ylpent-4-enal (PubChem CID 146167139) has the molecular formula C15H13ClO and a molecular weight of 244.72 g/mol. Its IUPAC name is (2R,3R)-2-chloro-3-naphthalen-2-ylpent-4-enal.
| Compound Name | (2R,3R)-2-chloro-3-naphthalen-2-ylpent-4-enal |
|---|---|
| PubChem CID | 146167139 |
| Molecular Formula | C15H13ClO |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (2R,3R)-2-chloro-3-naphthalen-2-ylpent-4-enal |
| SMILES | C=C[C@H](c1ccc2ccccc2c1)[C@@H](Cl)C=O |
| InChI | InChI=1S/C15H13ClO/c1-2-14(15(16)10-17)13-8-7-11-5-3-4-6-12(11)9-13/h2-10,14-15H,1H2/t14-,15+/m1/s1 |
| InChIKey | PZBQZVAINQOFBZ-CABCVRRESA-N |
| XLogP | 3.92 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|