C26H20NO2S+ — CID 139223134
3-[(E)-2-(3-benzyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-8-methylchromen-4-one (PubChem CID 139223134) has the molecular formula C26H20NO2S+ and a molecular weight of 410.52 g/mol. Its IUPAC name is 3-[(E)-2-(3-benzyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-8-methylchromen-4-one.
| Compound Name | 3-[(E)-2-(3-benzyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-8-methylchromen-4-one |
|---|---|
| PubChem CID | 139223134 |
| Molecular Formula | C26H20NO2S+ |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 3-[(E)-2-(3-benzyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-8-methylchromen-4-one |
| SMILES | Cc1cccc2c(=O)c(/C=C/c3sc4ccccc4[n+]3Cc3ccccc3)coc12 |
| InChI | InChI=1S/C26H20NO2S/c1-18-8-7-11-21-25(28)20(17-29-26(18)21)14-15-24-27(16-19-9-3-2-4-10-19)22-12-5-6-13-23(22)30-24/h2-15,17H,16H2,1H3/q+1/b15-14+ |
| InChIKey | JMVVRKMWTPKCBG-CCEZHUSRSA-N |
| XLogP | 5.82 |
| TPSA | 34.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|