C28H33IN2S — CID 67571245
4-[(E)-2-(3-heptyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N,N-dimethylnaphthalen-1-amine iodide (PubChem CID 67571245) has the molecular formula C28H33IN2S and a molecular weight of 556.56 g/mol. Its IUPAC name is 4-[(E)-2-(3-heptyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N,N-dimethylnaphthalen-1-amine iodide.
| Compound Name | 4-[(E)-2-(3-heptyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N,N-dimethylnaphthalen-1-amine iodide |
|---|---|
| PubChem CID | 67571245 |
| Molecular Formula | C28H33IN2S |
| Molecular Weight | 556.56 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | 4-[(E)-2-(3-heptyl-1,3-benzothiazol-3-ium-2-yl)ethenyl]-N,N-dimethylnaphthalen-1-amine iodide |
| SMILES | CCCCCCC[n+]1c(/C=C/c2ccc(N(C)C)c3ccccc23)sc2ccccc21.[I-] |
| InChI | InChI=1S/C28H33N2S.HI/c1-4-5-6-7-12-21-30-26-15-10-11-16-27(26)31-28(30)20-18-22-17-19-25(29(2)3)24-14-9-8-13-23(22)24;/h8-11,13-20H,4-7,12,21H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | HVYHEWQVGQXAAL-UHFFFAOYSA-M |
| XLogP | 4.55 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|