C13H12O — CID 123923676
3-buta-1,3-dienyl-7-methyl-1-benzofuran (PubChem CID 123923676) has the molecular formula C13H12O and a molecular weight of 184.24 g/mol. Its IUPAC name is 3-buta-1,3-dienyl-7-methyl-1-benzofuran.
| Compound Name | 3-buta-1,3-dienyl-7-methyl-1-benzofuran |
|---|---|
| PubChem CID | 123923676 |
| Molecular Formula | C13H12O |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | 3-buta-1,3-dienyl-7-methyl-1-benzofuran |
| SMILES | C=CC=Cc1coc2c(C)cccc12 |
| InChI | InChI=1S/C13H12O/c1-3-4-7-11-9-14-13-10(2)6-5-8-12(11)13/h3-9H,1H2,2H3 |
| InChIKey | WERUXNIVVPXDBG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|